About 2-butyl-2-ethyloxolane;methane
2-butyl-2-ethyloxolane;methane (PubChem CID 159867268) has the molecular formula C11H24O
and a molecular weight of 172.31 g/mol. Its IUPAC name is 2-butyl-2-ethyloxolane;methane.
Molecular Properties
| Compound Name | 2-butyl-2-ethyloxolane;methane |
| PubChem CID | 159867268 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | 2-butyl-2-ethyloxolane;methane |
| SMILES | C.CCCCC1(CC)CCCO1 |
| InChI | InChI=1S/C10H20O.CH4/c1-3-5-7-10(4-2)8-6-9-11-10;/h3-9H2,1-2H3;1H4 |
| InChIKey | NRWUAXFXQNVKME-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butyl-2-ethyloxolane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-2-ethyloxolane;methane?
The IUPAC name of 2-butyl-2-ethyloxolane;methane (CID 159867268) is 2-butyl-2-ethyloxolane;methane.
What is the SMILES notation for 2-butyl-2-ethyloxolane;methane?
The canonical SMILES for 2-butyl-2-ethyloxolane;methane is C.CCCCC1(CC)CCCO1.
What is the InChIKey of 2-butyl-2-ethyloxolane;methane?
The InChIKey is NRWUAXFXQNVKME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.CH4/c1-3-5-7-10(4-2)8-6-9-11-10;/h3-9H2,1-2H3;1H4.
What are the key properties of 2-butyl-2-ethyloxolane;methane?
2-butyl-2-ethyloxolane;methane has a molecular weight of 172.31 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-2-ethyloxolane;methane is sourced from PubChem (CID 159867268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).