C13H22F4O — CID 57090603
2,2-bis(4,4-difluorobutyl)oxane (PubChem CID 57090603) has the molecular formula C13H22F4O and a molecular weight of 270.31 g/mol. Its IUPAC name is 2,2-bis(4,4-difluorobutyl)oxane.
| Compound Name | 2,2-bis(4,4-difluorobutyl)oxane |
|---|---|
| PubChem CID | 57090603 |
| Molecular Formula | C13H22F4O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2,2-bis(4,4-difluorobutyl)oxane |
| SMILES | FC(F)CCCC1(CCCC(F)F)CCCCO1 |
| InChI | InChI=1S/C13H22F4O/c14-11(15)5-3-8-13(7-1-2-10-18-13)9-4-6-12(16)17/h11-12H,1-10H2 |
| InChIKey | UVVBFTXELWOBBR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |