About alumane;2,2-bis(2-methylpropyl)oxane
alumane;2,2-bis(2-methylpropyl)oxane (PubChem CID 173267840) has the molecular formula C13H29AlO
and a molecular weight of 228.36 g/mol. Its IUPAC name is alumane;2,2-bis(2-methylpropyl)oxane.
Molecular Properties
| Compound Name | alumane;2,2-bis(2-methylpropyl)oxane |
| PubChem CID | 173267840 |
| Molecular Formula | C13H29AlO |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | alumane;2,2-bis(2-methylpropyl)oxane |
| SMILES | CC(C)CC1(CC(C)C)CCCCO1.[AlH3] |
| InChI | InChI=1S/C13H26O.Al.3H/c1-11(2)9-13(10-12(3)4)7-5-6-8-14-13;;;;/h11-12H,5-10H2,1-4H3;;;; |
| InChIKey | GQIMGDWRAXYVER-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze alumane;2,2-bis(2-methylpropyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;2,2-bis(2-methylpropyl)oxane?
The IUPAC name of alumane;2,2-bis(2-methylpropyl)oxane (CID 173267840) is alumane;2,2-bis(2-methylpropyl)oxane.
What is the SMILES notation for alumane;2,2-bis(2-methylpropyl)oxane?
The canonical SMILES for alumane;2,2-bis(2-methylpropyl)oxane is CC(C)CC1(CC(C)C)CCCCO1.[AlH3].
What is the InChIKey of alumane;2,2-bis(2-methylpropyl)oxane?
The InChIKey is GQIMGDWRAXYVER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O.Al.3H/c1-11(2)9-13(10-12(3)4)7-5-6-8-14-13;;;;/h11-12H,5-10H2,1-4H3;;;;.
What are the key properties of alumane;2,2-bis(2-methylpropyl)oxane?
alumane;2,2-bis(2-methylpropyl)oxane has a molecular weight of 228.36 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;2,2-bis(2-methylpropyl)oxane is sourced from PubChem (CID 173267840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).