C14H32O2 — CID 178173409
2,2-dimethyloxane;ethane;3-methylbutan-1-ol (PubChem CID 178173409) has the molecular formula C14H32O2 and a molecular weight of 232.41 g/mol. Its IUPAC name is 2,2-dimethyloxane;ethane;3-methylbutan-1-ol.
| Compound Name | 2,2-dimethyloxane;ethane;3-methylbutan-1-ol |
|---|---|
| PubChem CID | 178173409 |
| Molecular Formula | C14H32O2 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.24 |
| IUPAC Name | 2,2-dimethyloxane;ethane;3-methylbutan-1-ol |
| SMILES | CC.CC(C)CCO.CC1(C)CCCCO1 |
| InChI | InChI=1S/C7H14O.C5H12O.C2H6/c1-7(2)5-3-4-6-8-7;1-5(2)3-4-6;1-2/h3-6H2,1-2H3;5-6H,3-4H2,1-2H3;1-2H3 |
| InChIKey | NJPFRJBZGGZRLH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |