About 18,18-dimethyl-1,4-dioxacyclooctadecan-5-one
18,18-dimethyl-1,4-dioxacyclooctadecan-5-one (PubChem CID 118518691) has the molecular formula C18H34O3
and a molecular weight of 298.47 g/mol. Its IUPAC name is 18,18-dimethyl-1,4-dioxacyclooctadecan-5-one.
Molecular Properties
| Compound Name | 18,18-dimethyl-1,4-dioxacyclooctadecan-5-one |
| PubChem CID | 118518691 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | 18,18-dimethyl-1,4-dioxacyclooctadecan-5-one |
| SMILES | CC1(C)CCCCCCCCCCCCC(=O)OCCO1 |
| InChI | InChI=1S/C18H34O3/c1-18(2)14-12-10-8-6-4-3-5-7-9-11-13-17(19)20-15-16-21-18/h3-16H2,1-2H3 |
| InChIKey | QXCVKSUJJAQHMD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 18,18-dimethyl-1,4-dioxacyclooctadecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 18,18-dimethyl-1,4-dioxacyclooctadecan-5-one?
The IUPAC name of 18,18-dimethyl-1,4-dioxacyclooctadecan-5-one (CID 118518691) is 18,18-dimethyl-1,4-dioxacyclooctadecan-5-one.
What is the SMILES notation for 18,18-dimethyl-1,4-dioxacyclooctadecan-5-one?
The canonical SMILES for 18,18-dimethyl-1,4-dioxacyclooctadecan-5-one is CC1(C)CCCCCCCCCCCCC(=O)OCCO1.
What is the InChIKey of 18,18-dimethyl-1,4-dioxacyclooctadecan-5-one?
The InChIKey is QXCVKSUJJAQHMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O3/c1-18(2)14-12-10-8-6-4-3-5-7-9-11-13-17(19)20-15-16-21-18/h3-16H2,1-2H3.
What are the key properties of 18,18-dimethyl-1,4-dioxacyclooctadecan-5-one?
18,18-dimethyl-1,4-dioxacyclooctadecan-5-one has a molecular weight of 298.47 g/mol, XLogP of 5.02, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 18,18-dimethyl-1,4-dioxacyclooctadecan-5-one is sourced from PubChem (CID 118518691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).