C8H19NO — CID 144836185
2,2-dimethyloxane;methanamine (PubChem CID 144836185) has the molecular formula C8H19NO and a molecular weight of 145.25 g/mol. Its IUPAC name is 2,2-dimethyloxane;methanamine.
| Compound Name | 2,2-dimethyloxane;methanamine |
|---|---|
| PubChem CID | 144836185 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | 2,2-dimethyloxane;methanamine |
| SMILES | CC1(C)CCCCO1.CN |
| InChI | InChI=1S/C7H14O.CH5N/c1-7(2)5-3-4-6-8-7;1-2/h3-6H2,1-2H3;2H2,1H3 |
| InChIKey | ZNAXZMUIZPCBPY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |