C19H42O5 — CID 91549300
2,2-diethoxypropane;2,2-dimethoxypropane;2,2-dimethyloxane (PubChem CID 91549300) has the molecular formula C19H42O5 and a molecular weight of 350.54 g/mol. Its IUPAC name is 2,2-diethoxypropane;2,2-dimethoxypropane;2,2-dimethyloxane.
| Compound Name | 2,2-diethoxypropane;2,2-dimethoxypropane;2,2-dimethyloxane |
|---|---|
| PubChem CID | 91549300 |
| Molecular Formula | C19H42O5 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | 2,2-diethoxypropane;2,2-dimethoxypropane;2,2-dimethyloxane |
| SMILES | CC1(C)CCCCO1.CCOC(C)(C)OCC.COC(C)(C)OC |
| InChI | InChI=1S/C7H16O2.C7H14O.C5H12O2/c1-5-8-7(3,4)9-6-2;1-7(2)5-3-4-6-8-7;1-5(2,6-3)7-4/h5-6H2,1-4H3;3-6H2,1-2H3;1-4H3 |
| InChIKey | KVWBJDYBDLSWGM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|