About ethene;2-ethoxy-2-methyloxane
ethene;2-ethoxy-2-methyloxane (PubChem CID 162017972) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is ethene;2-ethoxy-2-methyloxane.
Molecular Properties
| Compound Name | ethene;2-ethoxy-2-methyloxane |
| PubChem CID | 162017972 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | ethene;2-ethoxy-2-methyloxane |
| SMILES | C=C.CCOC1(C)CCCCO1 |
| InChI | InChI=1S/C8H16O2.C2H4/c1-3-9-8(2)6-4-5-7-10-8;1-2/h3-7H2,1-2H3;1-2H2 |
| InChIKey | YUJFOLWANJBTPR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;2-ethoxy-2-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;2-ethoxy-2-methyloxane?
The IUPAC name of ethene;2-ethoxy-2-methyloxane (CID 162017972) is ethene;2-ethoxy-2-methyloxane.
What is the SMILES notation for ethene;2-ethoxy-2-methyloxane?
The canonical SMILES for ethene;2-ethoxy-2-methyloxane is C=C.CCOC1(C)CCCCO1.
What is the InChIKey of ethene;2-ethoxy-2-methyloxane?
The InChIKey is YUJFOLWANJBTPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C2H4/c1-3-9-8(2)6-4-5-7-10-8;1-2/h3-7H2,1-2H3;1-2H2.
What are the key properties of ethene;2-ethoxy-2-methyloxane?
ethene;2-ethoxy-2-methyloxane has a molecular weight of 172.27 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-ethoxy-2-methyloxane is sourced from PubChem (CID 162017972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).