About methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane
methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane (PubChem CID 171551994) has the molecular formula C9H21NO
and a molecular weight of 159.27 g/mol. Its IUPAC name is methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane.
Molecular Properties
| Compound Name | methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane |
| PubChem CID | 171551994 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane |
| SMILES | C1CCC2(CC1)CCO2.CN.[H][H] |
| InChI | InChI=1S/C8H14O.CH5N.H2/c1-2-4-8(5-3-1)6-7-9-8;1-2;/h1-7H2;2H2,1H3;1H |
| InChIKey | UJOHMMAZICWKCQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane?
The IUPAC name of methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane (CID 171551994) is methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane.
What is the SMILES notation for methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane?
The canonical SMILES for methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane is C1CCC2(CC1)CCO2.CN.[H][H].
What is the InChIKey of methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane?
The InChIKey is UJOHMMAZICWKCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.CH5N.H2/c1-2-4-8(5-3-1)6-7-9-8;1-2;/h1-7H2;2H2,1H3;1H.
What are the key properties of methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane?
methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane has a molecular weight of 159.27 g/mol, XLogP of 1.93, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;molecular hydrogen;1-oxaspiro[3.5]nonane is sourced from PubChem (CID 171551994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).