About methanol;4-oxaspiro[2.4]heptane
methanol;4-oxaspiro[2.4]heptane (PubChem CID 144744375) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is methanol;4-oxaspiro[2.4]heptane.
Molecular Properties
| Compound Name | methanol;4-oxaspiro[2.4]heptane |
| PubChem CID | 144744375 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | methanol;4-oxaspiro[2.4]heptane |
| SMILES | C1COC2(C1)CC2.CO |
| InChI | InChI=1S/C6H10O.CH4O/c1-2-6(3-4-6)7-5-1;1-2/h1-5H2;2H,1H3 |
| InChIKey | ATRKEWXPNPWWHX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanol;4-oxaspiro[2.4]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;4-oxaspiro[2.4]heptane?
The IUPAC name of methanol;4-oxaspiro[2.4]heptane (CID 144744375) is methanol;4-oxaspiro[2.4]heptane.
What is the SMILES notation for methanol;4-oxaspiro[2.4]heptane?
The canonical SMILES for methanol;4-oxaspiro[2.4]heptane is C1COC2(C1)CC2.CO.
What is the InChIKey of methanol;4-oxaspiro[2.4]heptane?
The InChIKey is ATRKEWXPNPWWHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.CH4O/c1-2-6(3-4-6)7-5-1;1-2/h1-5H2;2H,1H3.
What are the key properties of methanol;4-oxaspiro[2.4]heptane?
methanol;4-oxaspiro[2.4]heptane has a molecular weight of 130.19 g/mol, XLogP of 0.94, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;4-oxaspiro[2.4]heptane is sourced from PubChem (CID 144744375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).