C15H24O3 — CID 101092012
(5R,6R,12R)-4,7,13-trioxatrispiro[4.0.46.1.412.25]octadecane (PubChem CID 101092012) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (5R,6R,12R)-4,7,13-trioxatrispiro[4.0.46.1.412.25]octadecane.
| Compound Name | (5R,6R,12R)-4,7,13-trioxatrispiro[4.0.46.1.412.25]octadecane |
|---|---|
| PubChem CID | 101092012 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (5R,6R,12R)-4,7,13-trioxatrispiro[4.0.46.1.412.25]octadecane |
| SMILES | C1CO[C@]2(C1)CC[C@]1(CCCO1)[C@@]1(CCCO1)C2 |
| InChI | InChI=1S/C15H24O3/c1-4-13(16-9-1)7-8-14(5-2-10-17-14)15(12-13)6-3-11-18-15/h1-12H2/t13-,14-,15-/m1/s1 |
| InChIKey | WVGHVUNEKYLWRG-RBSFLKMASA-N |
| XLogP | 2.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |