C19H32O — CID 135195190
(3R,6S,9S)-2,2,8,8,9-pentamethylspiro[octahydro-1H-2,4a-methanonapthalene-10,2'-oxolane] (PubChem CID 135195190) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is (3R,6S,9S)-2,2,8,8,9-pentamethylspiro[octahydro-1H-2,4a-methanonapthalene-10,2'-oxolane].
| Compound Name | (3R,6S,9S)-2,2,8,8,9-pentamethylspiro[octahydro-1H-2,4a-methanonapthalene-10,2'-oxolane] |
|---|---|
| PubChem CID | 135195190 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | (3R,6S,9S)-2,2,8,8,9-pentamethylspiro[octahydro-1H-2,4a-methanonapthalene-10,2'-oxolane] |
| SMILES | CC1(C)CCC2(CCCO2)[C@@]2(C)C(C)(C)[C@H]3CC[C@@]12C3 |
| InChI | InChI=1S/C19H32O/c1-15(2)10-11-19(8-6-12-20-19)17(5)16(3,4)14-7-9-18(15,17)13-14/h14H,6-13H2,1-5H3/t14-,17-,18+,19?/m0/s1 |
| InChIKey | YZSMZNNDPYLQRC-DYJHLDHHSA-N |
| XLogP | 5.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |