C10H18O2 — CID 45098524
2-cyclopentyl-2-methyl-1,3-dioxane (PubChem CID 45098524) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-cyclopentyl-2-methyl-1,3-dioxane.
| Compound Name | 2-cyclopentyl-2-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 45098524 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2-cyclopentyl-2-methyl-1,3-dioxane |
| SMILES | CC1(C2CCCC2)OCCCO1 |
| InChI | InChI=1S/C10H18O2/c1-10(9-5-2-3-6-9)11-7-4-8-12-10/h9H,2-8H2,1H3 |
| InChIKey | ROTRQKZRDQINMR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |