C9H16O — CID 11469119
(3aR,7aR)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran (PubChem CID 11469119) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (3aR,7aR)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran.
| Compound Name | (3aR,7aR)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran |
|---|---|
| PubChem CID | 11469119 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (3aR,7aR)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran |
| SMILES | C[C@@]12CCCC[C@@H]1CCO2 |
| InChI | InChI=1S/C9H16O/c1-9-6-3-2-4-8(9)5-7-10-9/h8H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | QJDDIMJWOGYCGI-RKDXNWHRSA-N |
| XLogP | 2.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |