C11H21NO — CID 131020831
2-cyclobutyl-N,2-dimethyloxan-4-amine (PubChem CID 131020831) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 2-cyclobutyl-N,2-dimethyloxan-4-amine.
| Compound Name | 2-cyclobutyl-N,2-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 131020831 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 2-cyclobutyl-N,2-dimethyloxan-4-amine |
| SMILES | CNC1CCOC(C)(C2CCC2)C1 |
| InChI | InChI=1S/C11H21NO/c1-11(9-4-3-5-9)8-10(12-2)6-7-13-11/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | AMRBOMMBXXGUFX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |