C12H22O — CID 19873304
5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-chromene (PubChem CID 19873304) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-chromene.
| Compound Name | 5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-chromene |
|---|---|
| PubChem CID | 19873304 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-chromene |
| SMILES | CC1(C)CCCC2(C)OCCCC12 |
| InChI | InChI=1S/C12H22O/c1-11(2)7-5-8-12(3)10(11)6-4-9-13-12/h10H,4-9H2,1-3H3 |
| InChIKey | RNMUOCFQIXGGLD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |