C16H28O — CID 12838595
(3aS,5aS,9aR,9bS)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran (PubChem CID 12838595) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (3aS,5aS,9aR,9bS)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran.
| Compound Name | (3aS,5aS,9aR,9bS)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran |
|---|---|
| PubChem CID | 12838595 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (3aS,5aS,9aR,9bS)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]1CC[C@]1(C)OCC[C@@H]21 |
| InChI | InChI=1S/C16H28O/c1-14(2)8-5-9-15(3)12(14)6-10-16(4)13(15)7-11-17-16/h12-13H,5-11H2,1-4H3/t12-,13-,15+,16-/m0/s1 |
| InChIKey | YPZUZOLGGMJZJO-UGQVUOCMSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |