C19H34O — CID 134865617
(4aR,10aS,10bR)-3,3,4a,7,7,10a-hexamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromene (PubChem CID 134865617) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is (4aR,10aS,10bR)-3,3,4a,7,7,10a-hexamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromene.
| Compound Name | (4aR,10aS,10bR)-3,3,4a,7,7,10a-hexamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromene |
|---|---|
| PubChem CID | 134865617 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | (4aR,10aS,10bR)-3,3,4a,7,7,10a-hexamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromene |
| SMILES | CC1(C)CC[C@H]2[C@@](C)(CCC3C(C)(C)CCC[C@@]32C)O1 |
| InChI | InChI=1S/C19H34O/c1-16(2)10-7-11-18(5)14(16)9-13-19(6)15(18)8-12-17(3,4)20-19/h14-15H,7-13H2,1-6H3/t14?,15-,18+,19-/m1/s1 |
| InChIKey | ZCNRQEIDXIQJAL-KTHDFGADSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |