C18H32O — CID 15600013
(4aR,6aS,10aS,10bR)-3,4a,7,7,10a-pentamethyl-1,2,3,5,6,6a,8,9,10,10b-decahydrobenzo[f]chromene (PubChem CID 15600013) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is (4aR,6aS,10aS,10bR)-3,4a,7,7,10a-pentamethyl-1,2,3,5,6,6a,8,9,10,10b-decahydrobenzo[f]chromene.
| Compound Name | (4aR,6aS,10aS,10bR)-3,4a,7,7,10a-pentamethyl-1,2,3,5,6,6a,8,9,10,10b-decahydrobenzo[f]chromene |
|---|---|
| PubChem CID | 15600013 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | (4aR,6aS,10aS,10bR)-3,4a,7,7,10a-pentamethyl-1,2,3,5,6,6a,8,9,10,10b-decahydrobenzo[f]chromene |
| SMILES | CC1CC[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3CC[C@@]2(C)O1 |
| InChI | InChI=1S/C18H32O/c1-13-7-8-15-17(4)11-6-10-16(2,3)14(17)9-12-18(15,5)19-13/h13-15H,6-12H2,1-5H3/t13?,14-,15+,17-,18+/m0/s1 |
| InChIKey | AJXYWYXUPTXLLM-LXWIVHRMSA-N |
| XLogP | 5.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |