C16H27O — CID 59886608
CID 59886608 (PubChem CID 59886608) has the molecular formula C16H27O and a molecular weight of 235.39 g/mol.
| Compound Name | CID 59886608 |
|---|---|
| PubChem CID | 59886608 |
| Molecular Formula | C16H27O |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.21 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC[C@@]2(C)C1CC[C@@]1(C)O[CH]C[C@@H]12 |
| InChI | InChI=1S/C16H27O/c1-14(2)8-5-9-15(3)12(14)6-10-16(4)13(15)7-11-17-16/h11-13H,5-10H2,1-4H3/t12?,13-,15+,16-/m1/s1 |
| InChIKey | QGJHIYWUYSVCPI-BHUMPYGKSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |