C16H26O3 — CID 71580669
(4aR,6aS,10aS,10bR)-4a,7,7,10a-tetramethyl-1,5,6,6a,8,9,10,10b-octahydronaphtho[2,1-d][1,3]dioxin-3-one (PubChem CID 71580669) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (4aR,6aS,10aS,10bR)-4a,7,7,10a-tetramethyl-1,5,6,6a,8,9,10,10b-octahydronaphtho[2,1-d][1,3]dioxin-3-one.
| Compound Name | (4aR,6aS,10aS,10bR)-4a,7,7,10a-tetramethyl-1,5,6,6a,8,9,10,10b-octahydronaphtho[2,1-d][1,3]dioxin-3-one |
|---|---|
| PubChem CID | 71580669 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (4aR,6aS,10aS,10bR)-4a,7,7,10a-tetramethyl-1,5,6,6a,8,9,10,10b-octahydronaphtho[2,1-d][1,3]dioxin-3-one |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1CC[C@@]1(C)OC(=O)OC[C@@H]21 |
| InChI | InChI=1S/C16H26O3/c1-14(2)7-5-8-15(3)11(14)6-9-16(4)12(15)10-18-13(17)19-16/h11-12H,5-10H2,1-4H3/t11-,12-,15-,16+/m0/s1 |
| InChIKey | JPCDFDYITMCEQI-GVAFMPQTSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |