C13H23BrO — CID 134901790
(2R,4aS,6R,8aS)-6-bromo-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-chromene (PubChem CID 134901790) has the molecular formula C13H23BrO and a molecular weight of 275.23 g/mol. Its IUPAC name is (2R,4aS,6R,8aS)-6-bromo-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-chromene.
| Compound Name | (2R,4aS,6R,8aS)-6-bromo-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-chromene |
|---|---|
| PubChem CID | 134901790 |
| Molecular Formula | C13H23BrO |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (2R,4aS,6R,8aS)-6-bromo-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-chromene |
| SMILES | C[C@@H]1CC[C@H]2C(C)(C)[C@H](Br)CC[C@]2(C)O1 |
| InChI | InChI=1S/C13H23BrO/c1-9-5-6-10-12(2,3)11(14)7-8-13(10,4)15-9/h9-11H,5-8H2,1-4H3/t9-,10+,11-,13+/m1/s1 |
| InChIKey | ZFSNDXGLMCWFPT-XZUYRWCXSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|