About 3-bromo-6-ethynyl-2,2,6-trimethyloxane
3-bromo-6-ethynyl-2,2,6-trimethyloxane (PubChem CID 71390397) has the molecular formula C10H15BrO
and a molecular weight of 231.13 g/mol. Its IUPAC name is 3-bromo-6-ethynyl-2,2,6-trimethyloxane.
Molecular Properties
| Compound Name | 3-bromo-6-ethynyl-2,2,6-trimethyloxane |
| PubChem CID | 71390397 |
| Molecular Formula | C10H15BrO |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 3-bromo-6-ethynyl-2,2,6-trimethyloxane |
| SMILES | C#CC1(C)CCC(Br)C(C)(C)O1 |
| InChI | InChI=1S/C10H15BrO/c1-5-10(4)7-6-8(11)9(2,3)12-10/h1,8H,6-7H2,2-4H3 |
| InChIKey | HNTNPGCWXWYKMY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-6-ethynyl-2,2,6-trimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-ethynyl-2,2,6-trimethyloxane?
The IUPAC name of 3-bromo-6-ethynyl-2,2,6-trimethyloxane (CID 71390397) is 3-bromo-6-ethynyl-2,2,6-trimethyloxane.
What is the SMILES notation for 3-bromo-6-ethynyl-2,2,6-trimethyloxane?
The canonical SMILES for 3-bromo-6-ethynyl-2,2,6-trimethyloxane is C#CC1(C)CCC(Br)C(C)(C)O1.
What is the InChIKey of 3-bromo-6-ethynyl-2,2,6-trimethyloxane?
The InChIKey is HNTNPGCWXWYKMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BrO/c1-5-10(4)7-6-8(11)9(2,3)12-10/h1,8H,6-7H2,2-4H3.
What are the key properties of 3-bromo-6-ethynyl-2,2,6-trimethyloxane?
3-bromo-6-ethynyl-2,2,6-trimethyloxane has a molecular weight of 231.13 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-ethynyl-2,2,6-trimethyloxane is sourced from PubChem (CID 71390397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).