C11H17BrO2 — CID 11346007
1-[(2S,5R)-5-bromo-2,6,6-trimethyloxan-2-yl]prop-2-en-1-one (PubChem CID 11346007) has the molecular formula C11H17BrO2 and a molecular weight of 261.16 g/mol. Its IUPAC name is 1-[(2S,5R)-5-bromo-2,6,6-trimethyloxan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S,5R)-5-bromo-2,6,6-trimethyloxan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 11346007 |
| Molecular Formula | C11H17BrO2 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1-[(2S,5R)-5-bromo-2,6,6-trimethyloxan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)[C@]1(C)CC[C@@H](Br)C(C)(C)O1 |
| InChI | InChI=1S/C11H17BrO2/c1-5-9(13)11(4)7-6-8(12)10(2,3)14-11/h5,8H,1,6-7H2,2-4H3/t8-,11+/m1/s1 |
| InChIKey | GSMOFQBSEJJHGK-KCJUWKMLSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|