C15H25Br2ClO — CID 44626954
(3R,6R)-3-bromo-6-[(1R,3R,4R)-3-bromo-4-chloro-4-methylcyclohexyl]-2,2,6-trimethyloxane (PubChem CID 44626954) has the molecular formula C15H25Br2ClO and a molecular weight of 416.63 g/mol. Its IUPAC name is (3R,6R)-3-bromo-6-[(1R,3R,4R)-3-bromo-4-chloro-4-methylcyclohexyl]-2,2,6-trimethyloxane.
| Compound Name | (3R,6R)-3-bromo-6-[(1R,3R,4R)-3-bromo-4-chloro-4-methylcyclohexyl]-2,2,6-trimethyloxane |
|---|---|
| PubChem CID | 44626954 |
| Molecular Formula | C15H25Br2ClO |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | (3R,6R)-3-bromo-6-[(1R,3R,4R)-3-bromo-4-chloro-4-methylcyclohexyl]-2,2,6-trimethyloxane |
| SMILES | CC1(C)O[C@@](C)([C@@H]2CC[C@@](C)(Cl)[C@H](Br)C2)CC[C@H]1Br |
| InChI | InChI=1S/C15H25Br2ClO/c1-13(2)11(16)6-8-15(4,19-13)10-5-7-14(3,18)12(17)9-10/h10-12H,5-9H2,1-4H3/t10-,11-,12-,14-,15-/m1/s1 |
| InChIKey | FIHHUYBIKUKVFD-URFZWBKFSA-N |
| XLogP | 5.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|