C15H25BrO3 — CID 162977842
(2R,5R,9S,10S)-5-bromo-2,4,4,9-tetramethyl-3,8-dioxatricyclo[7.2.2.02,7]tridecan-10-ol (PubChem CID 162977842) has the molecular formula C15H25BrO3 and a molecular weight of 333.27 g/mol. Its IUPAC name is (2R,5R,9S,10S)-5-bromo-2,4,4,9-tetramethyl-3,8-dioxatricyclo[7.2.2.02,7]tridecan-10-ol.
| Compound Name | (2R,5R,9S,10S)-5-bromo-2,4,4,9-tetramethyl-3,8-dioxatricyclo[7.2.2.02,7]tridecan-10-ol |
|---|---|
| PubChem CID | 162977842 |
| Molecular Formula | C15H25BrO3 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (2R,5R,9S,10S)-5-bromo-2,4,4,9-tetramethyl-3,8-dioxatricyclo[7.2.2.02,7]tridecan-10-ol |
| SMILES | CC1(C)O[C@]2(C)C3CC[C@](C)(OC2C[C@H]1Br)[C@@H](O)C3 |
| InChI | InChI=1S/C15H25BrO3/c1-13(2)10(16)8-12-15(4,19-13)9-5-6-14(3,18-12)11(17)7-9/h9-12,17H,5-8H2,1-4H3/t9?,10-,11+,12?,14+,15-/m1/s1 |
| InChIKey | IFRYZAZPOYZDBK-NWOHRIMVSA-N |
| XLogP | 3.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|