C17H28O5 — CID 177398832
[(1R,3R,4S,6S,7R,11R)-3-hydroxy-4,11-dimethyl-8-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-7-yl] acetate (PubChem CID 177398832) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(1R,3R,4S,6S,7R,11R)-3-hydroxy-4,11-dimethyl-8-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-7-yl] acetate.
| Compound Name | [(1R,3R,4S,6S,7R,11R)-3-hydroxy-4,11-dimethyl-8-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-7-yl] acetate |
|---|---|
| PubChem CID | 177398832 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [(1R,3R,4S,6S,7R,11R)-3-hydroxy-4,11-dimethyl-8-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(C(C)C)CC[C@@]2(C)O[C@@H]2C[C@@H](O)[C@]2(C)O[C@@H]12 |
| InChI | InChI=1S/C17H28O5/c1-9(2)11-6-7-16(4)13(21-16)8-12(19)17(5)15(22-17)14(11)20-10(3)18/h9,11-15,19H,6-8H2,1-5H3/t11?,12-,13-,14-,15+,16-,17+/m1/s1 |
| InChIKey | WWNRYMZXEMGUKG-YMSDJIDRSA-N |
| XLogP | 2.05 |
| TPSA | 71.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|