C17H30O4 — CID 15511534
1-[(2S,3aR,4R,5R,7aS)-4-(dimethoxymethyl)-7a-methyl-5-propan-2-yl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-2-yl]ethanone (PubChem CID 15511534) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is 1-[(2S,3aR,4R,5R,7aS)-4-(dimethoxymethyl)-7a-methyl-5-propan-2-yl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-2-yl]ethanone.
| Compound Name | 1-[(2S,3aR,4R,5R,7aS)-4-(dimethoxymethyl)-7a-methyl-5-propan-2-yl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-2-yl]ethanone |
|---|---|
| PubChem CID | 15511534 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 1-[(2S,3aR,4R,5R,7aS)-4-(dimethoxymethyl)-7a-methyl-5-propan-2-yl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-2-yl]ethanone |
| SMILES | COC(OC)[C@@H]1[C@@H](C(C)C)CC[C@]2(C)O[C@H](C(C)=O)C[C@H]12 |
| InChI | InChI=1S/C17H30O4/c1-10(2)12-7-8-17(4)13(9-14(21-17)11(3)18)15(12)16(19-5)20-6/h10,12-16H,7-9H2,1-6H3/t12-,13-,14+,15-,17+/m1/s1 |
| InChIKey | OCYUYJFVEABSMX-GAGVYUBLSA-N |
| XLogP | 3.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|