C23H30O7 — CID 135009207
[2-acetyl-3-acetyloxy-5-methoxy-4-[(1R,2S,3R,6S)-6-methyl-3-propan-2-yl-7-oxabicyclo[4.1.0]heptan-2-yl]phenyl] acetate (PubChem CID 135009207) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is [2-acetyl-3-acetyloxy-5-methoxy-4-[(1R,2S,3R,6S)-6-methyl-3-propan-2-yl-7-oxabicyclo[4.1.0]heptan-2-yl]phenyl] acetate.
| Compound Name | [2-acetyl-3-acetyloxy-5-methoxy-4-[(1R,2S,3R,6S)-6-methyl-3-propan-2-yl-7-oxabicyclo[4.1.0]heptan-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 135009207 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [2-acetyl-3-acetyloxy-5-methoxy-4-[(1R,2S,3R,6S)-6-methyl-3-propan-2-yl-7-oxabicyclo[4.1.0]heptan-2-yl]phenyl] acetate |
| SMILES | COc1cc(OC(C)=O)c(C(C)=O)c(OC(C)=O)c1[C@@H]1[C@@H](C(C)C)CC[C@]2(C)O[C@H]12 |
| InChI | InChI=1S/C23H30O7/c1-11(2)15-8-9-23(6)22(30-23)19(15)20-16(27-7)10-17(28-13(4)25)18(12(3)24)21(20)29-14(5)26/h10-11,15,19,22H,8-9H2,1-7H3/t15-,19+,22-,23+/m1/s1 |
| InChIKey | CPOSSELFWMQFQZ-VENCUUGQSA-N |
| XLogP | 4.06 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|