C21H30O4 — CID 102302376
methyl (1R,3aR,4S,5S,9bR)-5-hydroxy-6-methoxy-3a,8-dimethyl-1-propan-2-yl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene-4-carboxylate (PubChem CID 102302376) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl (1R,3aR,4S,5S,9bR)-5-hydroxy-6-methoxy-3a,8-dimethyl-1-propan-2-yl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene-4-carboxylate.
| Compound Name | methyl (1R,3aR,4S,5S,9bR)-5-hydroxy-6-methoxy-3a,8-dimethyl-1-propan-2-yl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene-4-carboxylate |
|---|---|
| PubChem CID | 102302376 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | methyl (1R,3aR,4S,5S,9bR)-5-hydroxy-6-methoxy-3a,8-dimethyl-1-propan-2-yl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene-4-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](O)c2c(OC)cc(C)cc2[C@@H]2[C@@H](C(C)C)CC[C@@]12C |
| InChI | InChI=1S/C21H30O4/c1-11(2)13-7-8-21(4)17(13)14-9-12(3)10-15(24-5)16(14)19(22)18(21)20(23)25-6/h9-11,13,17-19,22H,7-8H2,1-6H3/t13-,17+,18+,19-,21-/m1/s1 |
| InChIKey | VQHFEKNQEWKYMO-BBOJSFCZSA-N |
| XLogP | 4.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |