About methyl 5-hydroxy-2,2-dimethylcyclopentane-1-carboxylate
methyl 5-hydroxy-2,2-dimethylcyclopentane-1-carboxylate (PubChem CID 170070981) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is methyl 5-hydroxy-2,2-dimethylcyclopentane-1-carboxylate.
Analyze methyl 5-hydroxy-2,2-dimethylcyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-hydroxy-2,2-dimethylcyclopentane-1-carboxylate?
The IUPAC name of methyl 5-hydroxy-2,2-dimethylcyclopentane-1-carboxylate (CID 170070981) is methyl 5-hydroxy-2,2-dimethylcyclopentane-1-carboxylate.
What is the SMILES notation for methyl 5-hydroxy-2,2-dimethylcyclopentane-1-carboxylate?
The canonical SMILES for methyl 5-hydroxy-2,2-dimethylcyclopentane-1-carboxylate is COC(=O)C1C(O)CCC1(C)C.
What is the InChIKey of methyl 5-hydroxy-2,2-dimethylcyclopentane-1-carboxylate?
The InChIKey is HWKGKJGIJZVEHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-9(2)5-4-6(10)7(9)8(11)12-3/h6-7,10H,4-5H2,1-3H3.
What are the key properties of methyl 5-hydroxy-2,2-dimethylcyclopentane-1-carboxylate?
methyl 5-hydroxy-2,2-dimethylcyclopentane-1-carboxylate has a molecular weight of 172.22 g/mol, XLogP of 0.96, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-hydroxy-2,2-dimethylcyclopentane-1-carboxylate is sourced from PubChem (CID 170070981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).