C7H14O2 — CID 22245615
3,3-dimethylcyclopentane-1,2-diol (PubChem CID 22245615) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is 3,3-dimethylcyclopentane-1,2-diol.
| Compound Name | 3,3-dimethylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 22245615 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 3,3-dimethylcyclopentane-1,2-diol |
| SMILES | CC1(C)CCC(O)C1O |
| InChI | InChI=1S/C7H14O2/c1-7(2)4-3-5(8)6(7)9/h5-6,8-9H,3-4H2,1-2H3 |
| InChIKey | BQNVNLVPNSRNBZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |