C9H19NO — CID 79857600
5-(dimethylamino)-2,2-dimethylcyclopentan-1-ol (PubChem CID 79857600) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is 5-(dimethylamino)-2,2-dimethylcyclopentan-1-ol.
| Compound Name | 5-(dimethylamino)-2,2-dimethylcyclopentan-1-ol |
|---|---|
| PubChem CID | 79857600 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 5-(dimethylamino)-2,2-dimethylcyclopentan-1-ol |
| SMILES | CN(C)C1CCC(C)(C)C1O |
| InChI | InChI=1S/C9H19NO/c1-9(2)6-5-7(8(9)11)10(3)4/h7-8,11H,5-6H2,1-4H3 |
| InChIKey | AOFBXZAOVNDKGD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |