C10H22N2 — CID 79864117
1-N,1-N,2-N,3,3-pentamethylcyclopentane-1,2-diamine (PubChem CID 79864117) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 1-N,1-N,2-N,3,3-pentamethylcyclopentane-1,2-diamine.
| Compound Name | 1-N,1-N,2-N,3,3-pentamethylcyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 79864117 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 1-N,1-N,2-N,3,3-pentamethylcyclopentane-1,2-diamine |
| SMILES | CNC1C(N(C)C)CCC1(C)C |
| InChI | InChI=1S/C10H22N2/c1-10(2)7-6-8(12(4)5)9(10)11-3/h8-9,11H,6-7H2,1-5H3 |
| InChIKey | QALXDQDCERXRIU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |