C6H12O2 — CID 12791421
3,3-dimethylcyclobutane-1,2-diol (PubChem CID 12791421) has the molecular formula C6H12O2 and a molecular weight of 116.16 g/mol. Its IUPAC name is 3,3-dimethylcyclobutane-1,2-diol.
| Compound Name | 3,3-dimethylcyclobutane-1,2-diol |
|---|---|
| PubChem CID | 12791421 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | 3,3-dimethylcyclobutane-1,2-diol |
| SMILES | CC1(C)CC(O)C1O |
| InChI | InChI=1S/C6H12O2/c1-6(2)3-4(7)5(6)8/h4-5,7-8H,3H2,1-2H3 |
| InChIKey | WEKSLMZQHJLBGL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |