C7H11BrO2 — CID 549186
methyl 3-bromo-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 549186) has the molecular formula C7H11BrO2 and a molecular weight of 207.07 g/mol. Its IUPAC name is methyl 3-bromo-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | methyl 3-bromo-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 549186 |
| Molecular Formula | C7H11BrO2 |
| Molecular Weight | 207.07 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | methyl 3-bromo-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | COC(=O)C1C(Br)C1(C)C |
| InChI | InChI=1S/C7H11BrO2/c1-7(2)4(5(7)8)6(9)10-3/h4-5H,1-3H3 |
| InChIKey | WVCAMTYVOXYMIU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.07 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|