C10H14O4 — CID 139635749
(Z)-3-(3-methoxycarbonyl-2,2-dimethylcyclopropyl)prop-2-enoic acid (PubChem CID 139635749) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (Z)-3-(3-methoxycarbonyl-2,2-dimethylcyclopropyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(3-methoxycarbonyl-2,2-dimethylcyclopropyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 139635749 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (Z)-3-(3-methoxycarbonyl-2,2-dimethylcyclopropyl)prop-2-enoic acid |
| SMILES | COC(=O)C1C(/C=C\C(=O)O)C1(C)C |
| InChI | InChI=1S/C10H14O4/c1-10(2)6(4-5-7(11)12)8(10)9(13)14-3/h4-6,8H,1-3H3,(H,11,12)/b5-4- |
| InChIKey | XVGVRIYDHXJXPP-PLNGDYQASA-N |
| XLogP | 1.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|