C9H12O4 — CID 70394950
trans-(1S,3R)-3-[(Z)-2-carboxyethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 70394950) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is trans-(1S,3R)-3-[(Z)-2-carboxyethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | trans-(1S,3R)-3-[(Z)-2-carboxyethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 70394950 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | trans-(1S,3R)-3-[(Z)-2-carboxyethenyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](/C=C\C(=O)O)[C@@H]1C(=O)O |
| InChI | InChI=1S/C9H12O4/c1-9(2)5(3-4-6(10)11)7(9)8(12)13/h3-5,7H,1-2H3,(H,10,11)(H,12,13)/b4-3-/t5-,7-/m1/s1 |
| InChIKey | DNSNFJRJKJBPGP-UYPIMSBPSA-N |
| XLogP | 0.98 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|