C12H15F3O4 — CID 70489828
2,2-dimethyl-3-[(Z)-3-oxo-3-(3,3,3-trifluoropropoxy)prop-1-enyl]cyclopropane-1-carboxylic acid (PubChem CID 70489828) has the molecular formula C12H15F3O4 and a molecular weight of 280.24 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(Z)-3-oxo-3-(3,3,3-trifluoropropoxy)prop-1-enyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2,2-dimethyl-3-[(Z)-3-oxo-3-(3,3,3-trifluoropropoxy)prop-1-enyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 70489828 |
| Molecular Formula | C12H15F3O4 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2,2-dimethyl-3-[(Z)-3-oxo-3-(3,3,3-trifluoropropoxy)prop-1-enyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(/C=C\C(=O)OCCC(F)(F)F)C1C(=O)O |
| InChI | InChI=1S/C12H15F3O4/c1-11(2)7(9(11)10(17)18)3-4-8(16)19-6-5-12(13,14)15/h3-4,7,9H,5-6H2,1-2H3,(H,17,18)/b4-3- |
| InChIKey | ORHCCGJCLRSBLT-ARJAWSKDSA-N |
| XLogP | 2.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|