C12H12F6O4 — CID 157351627
trans-(1R,3S)-3-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 157351627) has the molecular formula C12H12F6O4 and a molecular weight of 334.21 g/mol. Its IUPAC name is trans-(1R,3S)-3-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | trans-(1R,3S)-3-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 157351627 |
| Molecular Formula | C12H12F6O4 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | trans-(1R,3S)-3-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)[C@@H]1C=CC(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H12F6O4/c1-10(2)5(7(10)8(20)21)3-4-6(19)22-9(11(13,14)15)12(16,17)18/h3-5,7,9H,1-2H3,(H,20,21)/t5-,7-/m0/s1 |
| InChIKey | BHPIPBQBVNRTCY-FSPLSTOPSA-N |
| XLogP | 2.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|