C11H15FO4 — CID 86743535
3-[(Z)-3-(2-fluoroethoxy)-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 86743535) has the molecular formula C11H15FO4 and a molecular weight of 230.23 g/mol. Its IUPAC name is 3-[(Z)-3-(2-fluoroethoxy)-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | 3-[(Z)-3-(2-fluoroethoxy)-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 86743535 |
| Molecular Formula | C11H15FO4 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 3-[(Z)-3-(2-fluoroethoxy)-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(/C=C\C(=O)OCCF)C1C(=O)O |
| InChI | InChI=1S/C11H15FO4/c1-11(2)7(9(11)10(14)15)3-4-8(13)16-6-5-12/h3-4,7,9H,5-6H2,1-2H3,(H,14,15)/b4-3- |
| InChIKey | JGCYUAOPGOUGDO-ARJAWSKDSA-N |
| XLogP | 1.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|