C11H17ClO4 — CID 70304838
3-(3-ethoxy-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride (PubChem CID 70304838) has the molecular formula C11H17ClO4 and a molecular weight of 248.71 g/mol. Its IUPAC name is 3-(3-ethoxy-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride.
| Compound Name | 3-(3-ethoxy-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 70304838 |
| Molecular Formula | C11H17ClO4 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-(3-ethoxy-3-oxoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid;hydrochloride |
| SMILES | CCOC(=O)C=CC1C(C(=O)O)C1(C)C.Cl |
| InChI | InChI=1S/C11H16O4.ClH/c1-4-15-8(12)6-5-7-9(10(13)14)11(7,2)3;/h5-7,9H,4H2,1-3H3,(H,13,14);1H |
| InChIKey | GCDLDALOPQCICJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|