C10H14O3 — CID 57004186
cis-(1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylic acid (PubChem CID 57004186) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is cis-(1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 57004186 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | cis-(1R,3R)-2,2-dimethyl-3-(3-oxobut-1-enyl)cyclopropane-1-carboxylic acid |
| SMILES | CC(=O)C=C[C@@H]1[C@@H](C(=O)O)C1(C)C |
| InChI | InChI=1S/C10H14O3/c1-6(11)4-5-7-8(9(12)13)10(7,2)3/h4-5,7-8H,1-3H3,(H,12,13)/t7-,8+/m1/s1 |
| InChIKey | AIWGJWSNEMYZKI-SFYZADRCSA-N |
| XLogP | 1.49 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|