C6H3F7O2 — CID 87421784
1,1,1,3,3,3-hexafluoropropan-2-yl 3-fluoroprop-2-enoate (PubChem CID 87421784) has the molecular formula C6H3F7O2 and a molecular weight of 240.07 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 3-fluoroprop-2-enoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 87421784 |
| Molecular Formula | C6H3F7O2 |
| Molecular Weight | 240.07 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-fluoroprop-2-enoate |
| SMILES | O=C(C=CF)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H3F7O2/c7-2-1-3(14)15-4(5(8,9)10)6(11,12)13/h1-2,4H |
| InChIKey | ZYWORHKPSIWWTH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.07 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|