C6H2F8O2 — CID 59386467
1,1,1,3,3,3-hexafluoropropan-2-yl (Z)-2,3-difluoroprop-2-enoate (PubChem CID 59386467) has the molecular formula C6H2F8O2 and a molecular weight of 258.06 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (Z)-2,3-difluoroprop-2-enoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (Z)-2,3-difluoroprop-2-enoate |
|---|---|
| PubChem CID | 59386467 |
| Molecular Formula | C6H2F8O2 |
| Molecular Weight | 258.06 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (Z)-2,3-difluoroprop-2-enoate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)/C(F)=C/F |
| InChI | InChI=1S/C6H2F8O2/c7-1-2(8)3(15)16-4(5(9,10)11)6(12,13)14/h1,4H/b2-1- |
| InChIKey | NLBCHYSFUCUDGY-UPHRSURJSA-N |
| XLogP | 2.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.06 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|