C5H6F6N2O2 — CID 174657461
1,1,1,3,3,3-hexafluoropropan-2-yl N-amino-N-methylcarbamate (PubChem CID 174657461) has the molecular formula C5H6F6N2O2 and a molecular weight of 240.10 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl N-amino-N-methylcarbamate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl N-amino-N-methylcarbamate |
|---|---|
| PubChem CID | 174657461 |
| Molecular Formula | C5H6F6N2O2 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl N-amino-N-methylcarbamate |
| SMILES | CN(N)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H6F6N2O2/c1-13(12)3(14)15-2(4(6,7)8)5(9,10)11/h2H,12H2,1H3 |
| InChIKey | DLQFNXBXBMLGGL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|