amino N-amino-N-methylcarbamate

C2H7N3O2 — CID 174563517

IUPACamino N-amino-N-methylcarbamate
SMILESCN(N)C(=O)ON
InChIInChI=1S/C2H7N3O2/c1-5(3)2(6)7-4/h3-4H2,1H3
InChIKeyKBYHVPGHIMLZQG-UHFFFAOYSA-N
MW105.10 g/mol
LogP-1.20
Rot. Bonds

About amino N-amino-N-methylcarbamate

amino N-amino-N-methylcarbamate (PubChem CID 174563517) has the molecular formula C2H7N3O2 and a molecular weight of 105.10 g/mol. Its IUPAC name is amino N-amino-N-methylcarbamate.

Molecular Properties

Compound Nameamino N-amino-N-methylcarbamate
PubChem CID174563517
Molecular FormulaC2H7N3O2
Molecular Weight105.10 g/mol
Exact Mass105.05
IUPAC Nameamino N-amino-N-methylcarbamate
SMILESCN(N)C(=O)ON
InChIInChI=1S/C2H7N3O2/c1-5(3)2(6)7-4/h3-4H2,1H3
InChIKeyKBYHVPGHIMLZQG-UHFFFAOYSA-N
XLogP-1.20
TPSA81.58 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500105.10
LogP ≤ 5-1.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino N-amino-N-methylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Methyl 1-methylhydrazine carboxylate
CID 316932
1-Methylhydrazine-1-carboxylic acid
CID 17977374
Nickel methyl-hydrazinecarboxylate
CID 129731351
Amino(methyl)carbamic acid;hydrochloride
CID 87562338
[Amino(methyl)amino]-methylcarbamic acid
CID 124142917
Amino(trideuteriomethyl)carbamic acid
CID 173838897
Amino(methyl)carbamic acid;hydrate
CID 174569460
N-methyl-N-(methylamino)carbamate
CID 23500233
CID 101482391
CID 101482391
[Methoxycarbonyl(methyl)amino]azanide
CID 164064727

Frequently Asked Questions

What is the IUPAC name of amino N-amino-N-methylcarbamate?
The IUPAC name of amino N-amino-N-methylcarbamate (CID 174563517) is amino N-amino-N-methylcarbamate.
What is the SMILES notation for amino N-amino-N-methylcarbamate?
The canonical SMILES for amino N-amino-N-methylcarbamate is CN(N)C(=O)ON.
What is the InChIKey of amino N-amino-N-methylcarbamate?
The InChIKey is KBYHVPGHIMLZQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7N3O2/c1-5(3)2(6)7-4/h3-4H2,1H3.
What are the key properties of amino N-amino-N-methylcarbamate?
amino N-amino-N-methylcarbamate has a molecular weight of 105.10 g/mol, XLogP of -1.20, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino N-amino-N-methylcarbamate is sourced from PubChem (CID 174563517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).