About CID 101482391
CID 101482391 (PubChem CID 101482391) has the molecular formula C3H7N2O2
and a molecular weight of 103.10 g/mol.
Molecular Properties
| Compound Name | CID 101482391 |
| PubChem CID | 101482391 |
| Molecular Formula | C3H7N2O2 |
| Molecular Weight | 103.10 g/mol |
| Exact Mass | 103.05 |
| IUPAC Name | — |
| SMILES | [CH2]N(N)C(=O)OC |
| InChI | InChI=1S/C3H7N2O2/c1-5(4)3(6)7-2/h1,4H2,2H3 |
| InChIKey | KXIBAOACFRORRD-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.10 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 101482391 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101482391?
The IUPAC name of CID 101482391 (CID 101482391) is not available.
What is the SMILES notation for CID 101482391?
The canonical SMILES for CID 101482391 is [CH2]N(N)C(=O)OC.
What is the InChIKey of CID 101482391?
The InChIKey is KXIBAOACFRORRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N2O2/c1-5(4)3(6)7-2/h1,4H2,2H3.
What are the key properties of CID 101482391?
CID 101482391 has a molecular weight of 103.10 g/mol, XLogP of -0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101482391 is sourced from PubChem (CID 101482391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).