C8H6F8O3 — CID 166734215
1,1,1,3,3,3-hexafluoropropan-2-yl 2,2-difluoro-3-oxopentanoate (PubChem CID 166734215) has the molecular formula C8H6F8O3 and a molecular weight of 302.12 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2,2-difluoro-3-oxopentanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2,2-difluoro-3-oxopentanoate |
|---|---|
| PubChem CID | 166734215 |
| Molecular Formula | C8H6F8O3 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2,2-difluoro-3-oxopentanoate |
| SMILES | CCC(=O)C(F)(F)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F8O3/c1-2-3(17)6(9,10)5(18)19-4(7(11,12)13)8(14,15)16/h4H,2H2,1H3 |
| InChIKey | HNPNQLGSYJRKKL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|