C9H10F6O3 — CID 102721459
2-ethyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)but-2-enoic acid (PubChem CID 102721459) has the molecular formula C9H10F6O3 and a molecular weight of 280.16 g/mol. Its IUPAC name is 2-ethyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)but-2-enoic acid.
| Compound Name | 2-ethyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)but-2-enoic acid |
|---|---|
| PubChem CID | 102721459 |
| Molecular Formula | C9H10F6O3 |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-ethyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)but-2-enoic acid |
| SMILES | CCC(=CCOC(C(F)(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H10F6O3/c1-2-5(6(16)17)3-4-18-7(8(10,11)12)9(13,14)15/h3,7H,2,4H2,1H3,(H,16,17) |
| InChIKey | WPPUCFLAKIXJFY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|